About 1-oxido-7H-purin-6-one
1-oxido-7H-purin-6-one (PubChem CID 71438070) has the molecular formula C5H3N4O2-
and a molecular weight of 151.11 g/mol. Its IUPAC name is 1-oxido-7H-purin-6-one.
Molecular Properties
| Compound Name | 1-oxido-7H-purin-6-one |
| PubChem CID | 71438070 |
| Molecular Formula | C5H3N4O2- |
| Molecular Weight | 151.11 g/mol |
| Exact Mass | 151.03 |
| IUPAC Name | 1-oxido-7H-purin-6-one |
| SMILES | O=c1c2[nH]cnc2ncn1[O-] |
| InChI | InChI=1S/C5H3N4O2/c10-5-3-4(7-1-6-3)8-2-9(5)11/h1-2H,(H,6,7)/q-1 |
| InChIKey | VPBBNFYMGQSVGH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.11 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 1-oxido-7H-purin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxido-7H-purin-6-one?
The IUPAC name of 1-oxido-7H-purin-6-one (CID 71438070) is 1-oxido-7H-purin-6-one.
What is the SMILES notation for 1-oxido-7H-purin-6-one?
The canonical SMILES for 1-oxido-7H-purin-6-one is O=c1c2[nH]cnc2ncn1[O-].
What is the InChIKey of 1-oxido-7H-purin-6-one?
The InChIKey is VPBBNFYMGQSVGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3N4O2/c10-5-3-4(7-1-6-3)8-2-9(5)11/h1-2H,(H,6,7)/q-1.
What are the key properties of 1-oxido-7H-purin-6-one?
1-oxido-7H-purin-6-one has a molecular weight of 151.11 g/mol, XLogP of -0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxido-7H-purin-6-one is sourced from PubChem (CID 71438070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).