About 7H-purine-6-sulfinate
7H-purine-6-sulfinate (PubChem CID 44538474) has the molecular formula C5H3N4O2S-
and a molecular weight of 183.17 g/mol. Its IUPAC name is 7H-purine-6-sulfinate.
Molecular Properties
| Compound Name | 7H-purine-6-sulfinate |
| PubChem CID | 44538474 |
| Molecular Formula | C5H3N4O2S- |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | 7H-purine-6-sulfinate |
| SMILES | O=S([O-])c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C5H4N4O2S/c10-12(11)5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H,10,11)(H,6,7,8,9)/p-1 |
| InChIKey | HHXQKAMEEHJDMV-UHFFFAOYSA-M |
| XLogP | -0.41 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 7H-purine-6-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-purine-6-sulfinate?
The IUPAC name of 7H-purine-6-sulfinate (CID 44538474) is 7H-purine-6-sulfinate.
What is the SMILES notation for 7H-purine-6-sulfinate?
The canonical SMILES for 7H-purine-6-sulfinate is O=S([O-])c1ncnc2nc[nH]c12.
What is the InChIKey of 7H-purine-6-sulfinate?
The InChIKey is HHXQKAMEEHJDMV-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H4N4O2S/c10-12(11)5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H,10,11)(H,6,7,8,9)/p-1.
What are the key properties of 7H-purine-6-sulfinate?
7H-purine-6-sulfinate has a molecular weight of 183.17 g/mol, XLogP of -0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-purine-6-sulfinate is sourced from PubChem (CID 44538474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).