C9H14N4O — CID 145187400
5,7-dimethyl-3H-imidazo[4,5-d]pyridazin-4-one;ethane (PubChem CID 145187400) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 5,7-dimethyl-3H-imidazo[4,5-d]pyridazin-4-one;ethane.
| Compound Name | 5,7-dimethyl-3H-imidazo[4,5-d]pyridazin-4-one;ethane |
|---|---|
| PubChem CID | 145187400 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 5,7-dimethyl-3H-imidazo[4,5-d]pyridazin-4-one;ethane |
| SMILES | CC.Cc1nn(C)c(=O)c2[nH]cnc12 |
| InChI | InChI=1S/C7H8N4O.C2H6/c1-4-5-6(9-3-8-5)7(12)11(2)10-4;1-2/h3H,1-2H3,(H,8,9);1-2H3 |
| InChIKey | PVZFBRVYYJYXME-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |