C4H2IN5O — CID 163286898
5-iodo-3H-imidazo[4,5-d]triazin-4-one (PubChem CID 163286898) has the molecular formula C4H2IN5O and a molecular weight of 263.00 g/mol. Its IUPAC name is 5-iodo-3H-imidazo[4,5-d]triazin-4-one.
| Compound Name | 5-iodo-3H-imidazo[4,5-d]triazin-4-one |
|---|---|
| PubChem CID | 163286898 |
| Molecular Formula | C4H2IN5O |
| Molecular Weight | 263.00 g/mol |
| Exact Mass | 262.93 |
| IUPAC Name | 5-iodo-3H-imidazo[4,5-d]triazin-4-one |
| SMILES | O=c1[nH]nnc2ncn(I)c12 |
| InChI | InChI=1S/C4H2IN5O/c5-10-1-6-3-2(10)4(11)8-9-7-3/h1H,(H,7,8,11) |
| InChIKey | JOEZCFVQYULSGM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.00 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|