C13H11F3N2O2 — CID 137254828
2-methyl-5-(3-methylphenoxy)-4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 137254828) has the molecular formula C13H11F3N2O2 and a molecular weight of 284.24 g/mol. Its IUPAC name is 2-methyl-5-(3-methylphenoxy)-4-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-methyl-5-(3-methylphenoxy)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137254828 |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-methyl-5-(3-methylphenoxy)-4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1cccc(Oc2c(C(F)(F)F)nc(C)[nH]c2=O)c1 |
| InChI | InChI=1S/C13H11F3N2O2/c1-7-4-3-5-9(6-7)20-10-11(13(14,15)16)17-8(2)18-12(10)19/h3-6H,1-2H3,(H,17,18,19) |
| InChIKey | CNKPQEPHCAFRSN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |