C21H23N5 — CID 137265337
N-[(3R,4R)-1-benzyl-4-(1H-pyrrol-2-ylmethylideneamino)pyrrolidin-3-yl]-1-(1H-pyrrol-2-yl)methanimine (PubChem CID 137265337) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is N-[(3R,4R)-1-benzyl-4-(1H-pyrrol-2-ylmethylideneamino)pyrrolidin-3-yl]-1-(1H-pyrrol-2-yl)methanimine.
| Compound Name | N-[(3R,4R)-1-benzyl-4-(1H-pyrrol-2-ylmethylideneamino)pyrrolidin-3-yl]-1-(1H-pyrrol-2-yl)methanimine |
|---|---|
| PubChem CID | 137265337 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-[(3R,4R)-1-benzyl-4-(1H-pyrrol-2-ylmethylideneamino)pyrrolidin-3-yl]-1-(1H-pyrrol-2-yl)methanimine |
| SMILES | C(=N/[C@@H]1CN(Cc2ccccc2)C[C@H]1/N=C/c1ccc[nH]1)\c1ccc[nH]1 |
| InChI | InChI=1S/C21H23N5/c1-2-6-17(7-3-1)14-26-15-20(24-12-18-8-4-10-22-18)21(16-26)25-13-19-9-5-11-23-19/h1-13,20-23H,14-16H2/b24-12+,25-13+/t20-,21-/m1/s1 |
| InChIKey | VOVKSKSUWUYDOX-QQRIYYNSSA-N |
| XLogP | 3.13 |
| TPSA | 59.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|