About CID 137266763
CID 137266763 (PubChem CID 137266763) has the molecular formula C24H21OSi
and a molecular weight of 353.52 g/mol.
Molecular Properties
| Compound Name | CID 137266763 |
| PubChem CID | 137266763 |
| Molecular Formula | C24H21OSi |
| Molecular Weight | 353.52 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)cc(O[Si](c2ccccc2)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C24H21OSi/c1-18-15-19(2)17-21(16-18)25-26(22-11-4-3-5-12-22)24-14-8-10-20-9-6-7-13-23(20)24/h3-17H,1-2H3 |
| InChIKey | UUIYTAFIGRTXHH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 137266763 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 137266763?
The IUPAC name of CID 137266763 (CID 137266763) is not available.
What is the SMILES notation for CID 137266763?
The canonical SMILES for CID 137266763 is Cc1cc(C)cc(O[Si](c2ccccc2)c2cccc3ccccc23)c1.
What is the InChIKey of CID 137266763?
The InChIKey is UUIYTAFIGRTXHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21OSi/c1-18-15-19(2)17-21(16-18)25-26(22-11-4-3-5-12-22)24-14-8-10-20-9-6-7-13-23(20)24/h3-17H,1-2H3.
What are the key properties of CID 137266763?
CID 137266763 has a molecular weight of 353.52 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 137266763 is sourced from PubChem (CID 137266763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).