C14H20N8O — CID 137267431
3-[3-[(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one (PubChem CID 137267431) has the molecular formula C14H20N8O and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-[3-[(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one.
| Compound Name | 3-[3-[(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 137267431 |
| Molecular Formula | C14H20N8O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 3-[3-[(3-tert-butyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]propyl]-1,4-dihydro-1,2,4-triazol-5-one |
| SMILES | CC(C)(C)c1nnc2ccc(NCCCc3n[nH]c(=O)[nH]3)nn12 |
| InChI | InChI=1S/C14H20N8O/c1-14(2,3)12-19-18-11-7-6-9(21-22(11)12)15-8-4-5-10-16-13(23)20-17-10/h6-7H,4-5,8H2,1-3H3,(H,15,21)(H2,16,17,20,23) |
| InChIKey | YCUDHOBOIDNQJY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 116.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|