C15H20N6O3S2 — CID 137268704
N-[2-[(1-tert-butyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 137268704) has the molecular formula C15H20N6O3S2 and a molecular weight of 396.50 g/mol. Its IUPAC name is N-[2-[(1-tert-butyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(1-tert-butyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 137268704 |
| Molecular Formula | C15H20N6O3S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | N-[2-[(1-tert-butyl-4-oxo-5H-pyrazolo[5,4-d]pyrimidin-6-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CC(C)(C)n1ncc2c(=O)[nH]c(NCCNS(=O)(=O)c3cccs3)nc21 |
| InChI | InChI=1S/C15H20N6O3S2/c1-15(2,3)21-12-10(9-17-21)13(22)20-14(19-12)16-6-7-18-26(23,24)11-5-4-8-25-11/h4-5,8-9,18H,6-7H2,1-3H3,(H2,16,19,20,22) |
| InChIKey | YYMSJNQARPHUPK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 121.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|