C8H13NO2 — CID 137272943
(E)-3-(C,N-dimethylcarbonimidoyl)-4-hydroxypent-3-en-2-one (PubChem CID 137272943) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is (E)-3-(C,N-dimethylcarbonimidoyl)-4-hydroxypent-3-en-2-one.
| Compound Name | (E)-3-(C,N-dimethylcarbonimidoyl)-4-hydroxypent-3-en-2-one |
|---|---|
| PubChem CID | 137272943 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (E)-3-(C,N-dimethylcarbonimidoyl)-4-hydroxypent-3-en-2-one |
| SMILES | C/N=C(C)/C(C(C)=O)=C(/C)O |
| InChI | InChI=1S/C8H13NO2/c1-5(9-4)8(6(2)10)7(3)11/h10H,1-4H3/b8-6+,9-5+ |
| InChIKey | YVYGVQUMBSZADL-RFSWUZDDSA-N |
| XLogP | 1.50 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|