C8H12ClNO — CID 123410463
4-chloro-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one (PubChem CID 123410463) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is 4-chloro-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one.
| Compound Name | 4-chloro-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one |
|---|---|
| PubChem CID | 123410463 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 4-chloro-3-(C,N-dimethylcarbonimidoyl)pent-3-en-2-one |
| SMILES | C/N=C(\C)C(C(C)=O)=C(C)Cl |
| InChI | InChI=1S/C8H12ClNO/c1-5(9)8(7(3)11)6(2)10-4/h1-4H3/b8-5?,10-6+ |
| InChIKey | CGGRAQFZHLOPCR-QAMTZMKGSA-N |
| XLogP | 2.18 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|