C11H19NO — CID 145023226
(E)-3,4-dimethyl-5-methyliminooct-3-en-2-one (PubChem CID 145023226) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (E)-3,4-dimethyl-5-methyliminooct-3-en-2-one.
| Compound Name | (E)-3,4-dimethyl-5-methyliminooct-3-en-2-one |
|---|---|
| PubChem CID | 145023226 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (E)-3,4-dimethyl-5-methyliminooct-3-en-2-one |
| SMILES | CCCC(=N\C)/C(C)=C(\C)C(C)=O |
| InChI | InChI=1S/C11H19NO/c1-6-7-11(12-5)9(3)8(2)10(4)13/h6-7H2,1-5H3/b9-8+,12-11+ |
| InChIKey | XMVVYJNNICXPKI-MVKOLZDDSA-N |
| XLogP | 2.78 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|