C30H23N7O6 — CID 137274562
2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(6-nitrobenzo[e]pyren-3-yl)amino]-1H-purin-6-one (PubChem CID 137274562) has the molecular formula C30H23N7O6 and a molecular weight of 577.56 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(6-nitrobenzo[e]pyren-3-yl)amino]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(6-nitrobenzo[e]pyren-3-yl)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 137274562 |
| Molecular Formula | C30H23N7O6 |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 577.17 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-8-[(6-nitrobenzo[e]pyren-3-yl)amino]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(Nc3ccc4c5ccccc5c5ccc([N+](=O)[O-])c6ccc3c4c65)n2[C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C30H23N7O6/c31-29-34-27-26(28(40)35-29)33-30(36(27)23-11-21(39)22(12-38)43-23)32-19-9-7-15-13-3-1-2-4-14(13)16-8-10-20(37(41)42)18-6-5-17(19)24(15)25(16)18/h1-10,21-23,38-39H,11-12H2,(H,32,33)(H3,31,34,35,40)/t21-,22+,23+/m0/s1 |
| InChIKey | WCQYWDGAHWJFEA-YTFSRNRJSA-N |
| XLogP | 4.04 |
| TPSA | 194.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|