C26H21N7O5 — CID 137219737
2-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-8-[(8-nitropyren-1-yl)amino]-1H-purin-6-one (PubChem CID 137219737) has the molecular formula C26H21N7O5 and a molecular weight of 511.50 g/mol. Its IUPAC name is 2-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-8-[(8-nitropyren-1-yl)amino]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-8-[(8-nitropyren-1-yl)amino]-1H-purin-6-one |
|---|---|
| PubChem CID | 137219737 |
| Molecular Formula | C26H21N7O5 |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 2-amino-9-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-8-[(8-nitropyren-1-yl)amino]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(Nc3ccc4ccc5ccc([N+](=O)[O-])c6ccc3c4c56)n2[C@H]2CC[C@@H](CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C26H21N7O5/c27-25-30-23-22(24(35)31-25)29-26(32(23)19-10-5-14(11-34)38-19)28-17-8-3-12-1-2-13-4-9-18(33(36)37)16-7-6-15(17)20(12)21(13)16/h1-4,6-9,14,19,34H,5,10-11H2,(H,28,29)(H3,27,30,31,35)/t14-,19+/m0/s1 |
| InChIKey | QZSUHMKZOKSFMG-IFXJQAMLSA-N |
| XLogP | 3.92 |
| TPSA | 174.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|