C18H18N5O3P — CID 143522342
2-amino-9-[5-(hydroxymethyl)oxolan-2-yl]-8-[2-(4-phosphanylphenyl)ethynyl]-1H-purin-6-one (PubChem CID 143522342) has the molecular formula C18H18N5O3P and a molecular weight of 383.35 g/mol. Its IUPAC name is 2-amino-9-[5-(hydroxymethyl)oxolan-2-yl]-8-[2-(4-phosphanylphenyl)ethynyl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[5-(hydroxymethyl)oxolan-2-yl]-8-[2-(4-phosphanylphenyl)ethynyl]-1H-purin-6-one |
|---|---|
| PubChem CID | 143522342 |
| Molecular Formula | C18H18N5O3P |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 2-amino-9-[5-(hydroxymethyl)oxolan-2-yl]-8-[2-(4-phosphanylphenyl)ethynyl]-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(C#Cc3ccc(P)cc3)n2C2CCC(CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H18N5O3P/c19-18-21-16-15(17(25)22-18)20-13(7-3-10-1-5-12(27)6-2-10)23(16)14-8-4-11(9-24)26-14/h1-2,5-6,11,14,24H,4,8-9,27H2,(H3,19,21,22,25) |
| InChIKey | APPMDWAUMJXYFD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|