C14H13ClFN5O2 — CID 137291412
(2R)-1-[5-chloro-2-(2-fluoro-4-pyridinyl)-6-oxo-1H-pyrimidin-4-yl]pyrrolidine-2-carboxamide (PubChem CID 137291412) has the molecular formula C14H13ClFN5O2 and a molecular weight of 337.74 g/mol. Its IUPAC name is (2R)-1-[5-chloro-2-(2-fluoro-4-pyridinyl)-6-oxo-1H-pyrimidin-4-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[5-chloro-2-(2-fluoro-4-pyridinyl)-6-oxo-1H-pyrimidin-4-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 137291412 |
| Molecular Formula | C14H13ClFN5O2 |
| Molecular Weight | 337.74 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (2R)-1-[5-chloro-2-(2-fluoro-4-pyridinyl)-6-oxo-1H-pyrimidin-4-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CCCN1c1nc(-c2ccnc(F)c2)[nH]c(=O)c1Cl |
| InChI | InChI=1S/C14H13ClFN5O2/c15-10-13(21-5-1-2-8(21)11(17)22)19-12(20-14(10)23)7-3-4-18-9(16)6-7/h3-4,6,8H,1-2,5H2,(H2,17,22)(H,19,20,23)/t8-/m1/s1 |
| InChIKey | VIYUHFIWOCUALU-MRVPVSSYSA-N |
| XLogP | 1.08 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.74 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|