C14H15ClFN5O — CID 137291490
4-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-5-chloro-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one (PubChem CID 137291490) has the molecular formula C14H15ClFN5O and a molecular weight of 323.76 g/mol. Its IUPAC name is 4-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-5-chloro-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one.
| Compound Name | 4-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-5-chloro-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137291490 |
| Molecular Formula | C14H15ClFN5O |
| Molecular Weight | 323.76 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-[(3S)-3-(aminomethyl)pyrrolidin-1-yl]-5-chloro-2-(2-fluoro-4-pyridinyl)-1H-pyrimidin-6-one |
| SMILES | NC[C@@H]1CCN(c2nc(-c3ccnc(F)c3)[nH]c(=O)c2Cl)C1 |
| InChI | InChI=1S/C14H15ClFN5O/c15-11-13(21-4-2-8(6-17)7-21)19-12(20-14(11)22)9-1-3-18-10(16)5-9/h1,3,5,8H,2,4,6-7,17H2,(H,19,20,22)/t8-/m0/s1 |
| InChIKey | PIHOBQFIOISXNE-QMMMGPOBSA-N |
| XLogP | 1.41 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.76 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|