C18H21ClFN5O2 — CID 137291629
5-chloro-2-(2-fluoro-4-pyridinyl)-4-(4-morpholin-4-ylpiperidin-1-yl)-1H-pyrimidin-6-one (PubChem CID 137291629) has the molecular formula C18H21ClFN5O2 and a molecular weight of 393.85 g/mol. Its IUPAC name is 5-chloro-2-(2-fluoro-4-pyridinyl)-4-(4-morpholin-4-ylpiperidin-1-yl)-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-(4-morpholin-4-ylpiperidin-1-yl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137291629 |
| Molecular Formula | C18H21ClFN5O2 |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-(4-morpholin-4-ylpiperidin-1-yl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(-c2ccnc(F)c2)nc(N2CCC(N3CCOCC3)CC2)c1Cl |
| InChI | InChI=1S/C18H21ClFN5O2/c19-15-17(22-16(23-18(15)26)12-1-4-21-14(20)11-12)25-5-2-13(3-6-25)24-7-9-27-10-8-24/h1,4,11,13H,2-3,5-10H2,(H,22,23,26) |
| InChIKey | UBILTRNMUQFPPL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|