C19H24ClFN6O — CID 146484081
5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 146484081) has the molecular formula C19H24ClFN6O and a molecular weight of 406.89 g/mol. Its IUPAC name is 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 146484081 |
| Molecular Formula | C19H24ClFN6O |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | CN1CCN(C2CCN(c3nc(-c4ccnc(F)c4)[nH]c(=O)c3Cl)CC2)CC1 |
| InChI | InChI=1S/C19H24ClFN6O/c1-25-8-10-26(11-9-25)14-3-6-27(7-4-14)18-16(20)19(28)24-17(23-18)13-2-5-22-15(21)12-13/h2,5,12,14H,3-4,6-11H2,1H3,(H,23,24,28) |
| InChIKey | PRAZYMZUGTWCDE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|