C19H22ClFN4O2 — CID 158558920
5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(3-methylbutanoyl)piperidin-1-yl]-1H-pyrimidin-6-one (PubChem CID 158558920) has the molecular formula C19H22ClFN4O2 and a molecular weight of 392.86 g/mol. Its IUPAC name is 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(3-methylbutanoyl)piperidin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(3-methylbutanoyl)piperidin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 158558920 |
| Molecular Formula | C19H22ClFN4O2 |
| Molecular Weight | 392.86 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 5-chloro-2-(2-fluoro-4-pyridinyl)-4-[4-(3-methylbutanoyl)piperidin-1-yl]-1H-pyrimidin-6-one |
| SMILES | CC(C)CC(=O)C1CCN(c2nc(-c3ccnc(F)c3)[nH]c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C19H22ClFN4O2/c1-11(2)9-14(26)12-4-7-25(8-5-12)18-16(20)19(27)24-17(23-18)13-3-6-22-15(21)10-13/h3,6,10-12H,4-5,7-9H2,1-2H3,(H,23,24,27) |
| InChIKey | HQQGGDWXYBBRTN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.86 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|