C11H20N2OS — CID 137292344
5-butyl-2-tert-butylimino-1,3-thiazolidin-4-one (PubChem CID 137292344) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 5-butyl-2-tert-butylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-butyl-2-tert-butylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137292344 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 5-butyl-2-tert-butylimino-1,3-thiazolidin-4-one |
| SMILES | CCCCC1S/C(=N\C(C)(C)C)NC1=O |
| InChI | InChI=1S/C11H20N2OS/c1-5-6-7-8-9(14)12-10(15-8)13-11(2,3)4/h8H,5-7H2,1-4H3,(H,12,13,14) |
| InChIKey | FRWRLLWQSASAKL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|