C12H15N3OS — CID 137292348
5-butyl-2-pyridin-4-ylimino-1,3-thiazolidin-4-one (PubChem CID 137292348) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 5-butyl-2-pyridin-4-ylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-butyl-2-pyridin-4-ylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137292348 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-butyl-2-pyridin-4-ylimino-1,3-thiazolidin-4-one |
| SMILES | CCCCC1S/C(=N/c2ccncc2)NC1=O |
| InChI | InChI=1S/C12H15N3OS/c1-2-3-4-10-11(16)15-12(17-10)14-9-5-7-13-8-6-9/h5-8,10H,2-4H2,1H3,(H,13,14,15,16) |
| InChIKey | QMWSXDIOUKGHDJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|