C37H23N4O10+ — CID 137292668
2-[(E,3E)-3-[4,6-bis(4-nitrophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-nitrophenyl)pyrylium (PubChem CID 137292668) has the molecular formula C37H23N4O10+ and a molecular weight of 683.61 g/mol. Its IUPAC name is 2-[(E,3E)-3-[4,6-bis(4-nitrophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-nitrophenyl)pyrylium.
| Compound Name | 2-[(E,3E)-3-[4,6-bis(4-nitrophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-nitrophenyl)pyrylium |
|---|---|
| PubChem CID | 137292668 |
| Molecular Formula | C37H23N4O10+ |
| Molecular Weight | 683.61 g/mol |
| Exact Mass | 683.14 |
| IUPAC Name | 2-[(E,3E)-3-[4,6-bis(4-nitrophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-nitrophenyl)pyrylium |
| SMILES | O=[N+]([O-])c1ccc(C2=C/C(=C\C=C\c3cc(-c4ccc([N+](=O)[O-])cc4)cc(-c4ccc([N+](=O)[O-])cc4)[o+]3)OC(c3ccc([N+](=O)[O-])cc3)=C2)cc1 |
| InChI | InChI=1S/C37H23N4O10/c42-38(43)30-12-4-24(5-13-30)28-20-34(50-36(22-28)26-8-16-32(17-9-26)40(46)47)2-1-3-35-21-29(25-6-14-31(15-7-25)39(44)45)23-37(51-35)27-10-18-33(19-11-27)41(48)49/h1-23H/q+1 |
| InChIKey | ZHFOWPKVKFAXAK-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 193.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.61 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|