C37H23Cl4O2+ — CID 137292667
2-[(E,3E)-3-[4,6-bis(4-chlorophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-chlorophenyl)pyrylium (PubChem CID 137292667) has the molecular formula C37H23Cl4O2+ and a molecular weight of 641.40 g/mol. Its IUPAC name is 2-[(E,3E)-3-[4,6-bis(4-chlorophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-chlorophenyl)pyrylium.
| Compound Name | 2-[(E,3E)-3-[4,6-bis(4-chlorophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-chlorophenyl)pyrylium |
|---|---|
| PubChem CID | 137292667 |
| Molecular Formula | C37H23Cl4O2+ |
| Molecular Weight | 641.40 g/mol |
| Exact Mass | 639.04 |
| IUPAC Name | 2-[(E,3E)-3-[4,6-bis(4-chlorophenyl)pyran-2-ylidene]prop-1-enyl]-4,6-bis(4-chlorophenyl)pyrylium |
| SMILES | Clc1ccc(C2=C/C(=C\C=C\c3cc(-c4ccc(Cl)cc4)cc(-c4ccc(Cl)cc4)[o+]3)OC(c3ccc(Cl)cc3)=C2)cc1 |
| InChI | InChI=1S/C37H23Cl4O2/c38-30-12-4-24(5-13-30)28-20-34(42-36(22-28)26-8-16-32(40)17-9-26)2-1-3-35-21-29(25-6-14-31(39)15-7-25)23-37(43-35)27-10-18-33(41)19-11-27/h1-23H/q+1 |
| InChIKey | XWECZQQGAKCUSF-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.40 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|