C17H14ClN5 — CID 137294058
9-(2-chlorophenyl)-6,12-dimethyl-2,4,5,8,11-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene (PubChem CID 137294058) has the molecular formula C17H14ClN5 and a molecular weight of 323.79 g/mol. Its IUPAC name is 9-(2-chlorophenyl)-6,12-dimethyl-2,4,5,8,11-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene.
| Compound Name | 9-(2-chlorophenyl)-6,12-dimethyl-2,4,5,8,11-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene |
|---|---|
| PubChem CID | 137294058 |
| Molecular Formula | C17H14ClN5 |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 9-(2-chlorophenyl)-6,12-dimethyl-2,4,5,8,11-pentazatricyclo[8.4.0.03,7]tetradeca-1(10),3,6,8,11,13-hexaene |
| SMILES | Cc1ccc2c(n1)C(c1ccccc1Cl)=Nc1c(n[nH]c1C)N2 |
| InChI | InChI=1S/C17H14ClN5/c1-9-7-8-13-16(19-9)15(11-5-3-4-6-12(11)18)21-14-10(2)22-23-17(14)20-13/h3-8H,1-2H3,(H2,20,22,23) |
| InChIKey | VBOALLGSKCUAAQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |