C20H22O5 — CID 137294218
methyl 2-[(1S,5S)-1-methyl-2-oxo-5-[(1R,8S,11R)-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-11-yl]cyclopentyl]acetate (PubChem CID 137294218) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is methyl 2-[(1S,5S)-1-methyl-2-oxo-5-[(1R,8S,11R)-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-11-yl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1S,5S)-1-methyl-2-oxo-5-[(1R,8S,11R)-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-11-yl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 137294218 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | methyl 2-[(1S,5S)-1-methyl-2-oxo-5-[(1R,8S,11R)-10-oxo-9-oxatricyclo[6.2.2.02,7]dodeca-2,4,6-trien-11-yl]cyclopentyl]acetate |
| SMILES | COC(=O)C[C@]1(C)C(=O)CC[C@H]1[C@H]1C[C@@H]2OC(=O)[C@H]1c1ccccc12 |
| InChI | InChI=1S/C20H22O5/c1-20(10-17(22)24-2)14(7-8-16(20)21)13-9-15-11-5-3-4-6-12(11)18(13)19(23)25-15/h3-6,13-15,18H,7-10H2,1-2H3/t13-,14+,15+,18+,20+/m1/s1 |
| InChIKey | QPJVLJXFOFNCEM-GKMPKXBTSA-N |
| XLogP | 2.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |