C12H21O4- — CID 137298400
(E)-2-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate (PubChem CID 137298400) has the molecular formula C12H21O4- and a molecular weight of 229.30 g/mol. Its IUPAC name is (E)-2-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate.
| Compound Name | (E)-2-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate |
|---|---|
| PubChem CID | 137298400 |
| Molecular Formula | C12H21O4- |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | (E)-2-methyl-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate |
| SMILES | C/C(C(=O)OC(C)(C)C)=C(/[O-])OC(C)(C)C |
| InChI | InChI=1S/C12H22O4/c1-8(9(13)15-11(2,3)4)10(14)16-12(5,6)7/h13H,1-7H3/p-1/b9-8+ |
| InChIKey | SQVBYUIGTHRRKJ-CMDGGOBGSA-M |
| XLogP | 1.74 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|