C22H23ClN4O2 — CID 137299556
2-benzyl-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-4H-1,2,4-triazol-3-one (PubChem CID 137299556) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is 2-benzyl-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-4H-1,2,4-triazol-3-one.
| Compound Name | 2-benzyl-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-4H-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 137299556 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-benzyl-5-[1-[2-(3-chlorophenyl)acetyl]piperidin-4-yl]-4H-1,2,4-triazol-3-one |
| SMILES | O=C(Cc1cccc(Cl)c1)N1CCC(c2nn(Cc3ccccc3)c(=O)[nH]2)CC1 |
| InChI | InChI=1S/C22H23ClN4O2/c23-19-8-4-7-17(13-19)14-20(28)26-11-9-18(10-12-26)21-24-22(29)27(25-21)15-16-5-2-1-3-6-16/h1-8,13,18H,9-12,14-15H2,(H,24,25,29) |
| InChIKey | GMTULQXJWPIRHY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |