C21H19N5O — CID 137314546
2-[(E)-C-methyl-N-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)amino]carbonimidoyl]naphthalen-1-ol (PubChem CID 137314546) has the molecular formula C21H19N5O and a molecular weight of 357.42 g/mol. Its IUPAC name is 2-[(E)-C-methyl-N-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)amino]carbonimidoyl]naphthalen-1-ol.
| Compound Name | 2-[(E)-C-methyl-N-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)amino]carbonimidoyl]naphthalen-1-ol |
|---|---|
| PubChem CID | 137314546 |
| Molecular Formula | C21H19N5O |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-[(E)-C-methyl-N-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)amino]carbonimidoyl]naphthalen-1-ol |
| SMILES | C/C(=N\Nc1nnc(-c2ccccc2)n1C)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C21H19N5O/c1-14(17-13-12-15-8-6-7-11-18(15)19(17)27)22-24-21-25-23-20(26(21)2)16-9-4-3-5-10-16/h3-13,27H,1-2H3,(H,24,25)/b22-14+ |
| InChIKey | FEAFBNDDPACJKG-HYARGMPZSA-N |
| XLogP | 4.18 |
| TPSA | 75.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|