C17H28Br2Si — CID 137327717
[2,5-bis(bromomethyl)phenyl]-(2-methyloctyl)silane (PubChem CID 137327717) has the molecular formula C17H28Br2Si and a molecular weight of 420.31 g/mol. Its IUPAC name is [2,5-bis(bromomethyl)phenyl]-(2-methyloctyl)silane.
| Compound Name | [2,5-bis(bromomethyl)phenyl]-(2-methyloctyl)silane |
|---|---|
| PubChem CID | 137327717 |
| Molecular Formula | C17H28Br2Si |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | [2,5-bis(bromomethyl)phenyl]-(2-methyloctyl)silane |
| SMILES | CCCCCCC(C)C[SiH2]c1cc(CBr)ccc1CBr |
| InChI | InChI=1S/C17H28Br2Si/c1-3-4-5-6-7-14(2)13-20-17-10-15(11-18)8-9-16(17)12-19/h8-10,14H,3-7,11-13,20H2,1-2H3 |
| InChIKey | LHGNCUOUQAFXOR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|