C72H118O13Si2 — CID 137329899
bis(2,3,4-tributoxyphenyl)silyloxy-bis(2,3,4-tributoxyphenyl)silane (PubChem CID 137329899) has the molecular formula C72H118O13Si2 and a molecular weight of 1247.89 g/mol. Its IUPAC name is bis(2,3,4-tributoxyphenyl)silyloxy-bis(2,3,4-tributoxyphenyl)silane.
| Compound Name | bis(2,3,4-tributoxyphenyl)silyloxy-bis(2,3,4-tributoxyphenyl)silane |
|---|---|
| PubChem CID | 137329899 |
| Molecular Formula | C72H118O13Si2 |
| Molecular Weight | 1247.89 g/mol |
| Exact Mass | 1246.81 |
| IUPAC Name | bis(2,3,4-tributoxyphenyl)silyloxy-bis(2,3,4-tributoxyphenyl)silane |
| SMILES | CCCCOc1ccc([SiH](O[SiH](c2ccc(OCCCC)c(OCCCC)c2OCCCC)c2ccc(OCCCC)c(OCCCC)c2OCCCC)c2ccc(OCCCC)c(OCCCC)c2OCCCC)c(OCCCC)c1OCCCC |
| InChI | InChI=1S/C72H118O13Si2/c1-13-25-45-73-57-37-41-61(69(81-53-33-21-9)65(57)77-49-29-17-5)86(62-42-38-58(74-46-26-14-2)66(78-50-30-18-6)70(62)82-54-34-22-10)85-87(63-43-39-59(75-47-27-15-3)67(79-51-31-19-7)71(63)83-55-35-23-11)64-44-40-60(76-48-28-16-4)68(80-52-32-20-8)72(64)84-56-36-24-12/h37-44,86-87H,13-36,45-56H2,1-12H3 |
| InChIKey | DAYJIHNDZKMEMZ-UHFFFAOYSA-N |
| XLogP | 16.23 |
| TPSA | 119.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 87 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1247.89 |
| LogP ≤ 5 | 16.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|