C25H35NO3 — CID 101367591
4-[(E)-2-(2,3,4-tributoxyphenyl)ethenyl]pyridine (PubChem CID 101367591) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is 4-[(E)-2-(2,3,4-tributoxyphenyl)ethenyl]pyridine.
| Compound Name | 4-[(E)-2-(2,3,4-tributoxyphenyl)ethenyl]pyridine |
|---|---|
| PubChem CID | 101367591 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | 4-[(E)-2-(2,3,4-tributoxyphenyl)ethenyl]pyridine |
| SMILES | CCCCOc1ccc(/C=C/c2ccncc2)c(OCCCC)c1OCCCC |
| InChI | InChI=1S/C25H35NO3/c1-4-7-18-27-23-13-12-22(11-10-21-14-16-26-17-15-21)24(28-19-8-5-2)25(23)29-20-9-6-3/h10-17H,4-9,18-20H2,1-3H3/b11-10+ |
| InChIKey | XMMFIHUMCYXTNH-ZHACJKMWSA-N |
| XLogP | 6.79 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|