C8H10O2Si2 — CID 137330972
(8-silyloxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)oxysilane (PubChem CID 137330972) has the molecular formula C8H10O2Si2 and a molecular weight of 194.34 g/mol. Its IUPAC name is (8-silyloxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)oxysilane.
| Compound Name | (8-silyloxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)oxysilane |
|---|---|
| PubChem CID | 137330972 |
| Molecular Formula | C8H10O2Si2 |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | (8-silyloxy-7-bicyclo[4.2.0]octa-1,3,5,7-tetraenyl)oxysilane |
| SMILES | [SiH3]OC1=C(O[SiH3])c2ccccc21 |
| InChI | InChI=1S/C8H10O2Si2/c11-9-7-5-3-1-2-4-6(5)8(7)10-12/h1-4H,11-12H3 |
| InChIKey | CCTGJLPBRMTQMJ-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|