C14H17ClFN3O — CID 137335185
2-[(3-chloro-4-fluorophenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol (PubChem CID 137335185) has the molecular formula C14H17ClFN3O and a molecular weight of 297.76 g/mol. Its IUPAC name is 2-[(3-chloro-4-fluorophenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol.
| Compound Name | 2-[(3-chloro-4-fluorophenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol |
|---|---|
| PubChem CID | 137335185 |
| Molecular Formula | C14H17ClFN3O |
| Molecular Weight | 297.76 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-[(3-chloro-4-fluorophenyl)methyl-[(2-methyl-1H-imidazol-5-yl)methyl]amino]ethanol |
| SMILES | Cc1ncc(CN(CCO)Cc2ccc(F)c(Cl)c2)[nH]1 |
| InChI | InChI=1S/C14H17ClFN3O/c1-10-17-7-12(18-10)9-19(4-5-20)8-11-2-3-14(16)13(15)6-11/h2-3,6-7,20H,4-5,8-9H2,1H3,(H,17,18) |
| InChIKey | FEWNWYHSBAGGBZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.76 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |