C15H10ClFN2OS — CID 137335223
4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-2-chloro-5-fluorophenol (PubChem CID 137335223) has the molecular formula C15H10ClFN2OS and a molecular weight of 320.78 g/mol. Its IUPAC name is 4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-2-chloro-5-fluorophenol.
| Compound Name | 4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-2-chloro-5-fluorophenol |
|---|---|
| PubChem CID | 137335223 |
| Molecular Formula | C15H10ClFN2OS |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 4-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-2-chloro-5-fluorophenol |
| SMILES | Nc1nc(-c2ccc(-c3cc(Cl)c(O)cc3F)cc2)cs1 |
| InChI | InChI=1S/C15H10ClFN2OS/c16-11-5-10(12(17)6-14(11)20)8-1-3-9(4-2-8)13-7-21-15(18)19-13/h1-7,20H,(H2,18,19) |
| InChIKey | KXOIPQGSCYWMGC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |