C21H23NO6 — CID 137340489
(3aR,7aR)-2-[3-methyl-5-(phenoxymethyl)furan-2-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137340489) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (3aR,7aR)-2-[3-methyl-5-(phenoxymethyl)furan-2-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[3-methyl-5-(phenoxymethyl)furan-2-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137340489 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (3aR,7aR)-2-[3-methyl-5-(phenoxymethyl)furan-2-carbonyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | Cc1cc(COc2ccccc2)oc1C(=O)N1C[C@@H]2COCC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C21H23NO6/c1-14-9-17(12-27-16-5-3-2-4-6-16)28-18(14)19(23)22-10-15-11-26-8-7-21(15,13-22)20(24)25/h2-6,9,15H,7-8,10-13H2,1H3,(H,24,25)/t15-,21+/m1/s1 |
| InChIKey | PVFVCBDFOBKYLV-VFNWGFHPSA-N |
| XLogP | 2.73 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |