C21H27N3O3 — CID 91797813
(8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-[3-methyl-5-(phenoxymethyl)furan-2-yl]methanone (PubChem CID 91797813) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-[3-methyl-5-(phenoxymethyl)furan-2-yl]methanone.
| Compound Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-[3-methyl-5-(phenoxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 91797813 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (8-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl)-[3-methyl-5-(phenoxymethyl)furan-2-yl]methanone |
| SMILES | Cc1cc(COc2ccccc2)oc1C(=O)N1CCN2CCN(C)CC2C1 |
| InChI | InChI=1S/C21H27N3O3/c1-16-12-19(15-26-18-6-4-3-5-7-18)27-20(16)21(25)24-11-10-23-9-8-22(2)13-17(23)14-24/h3-7,12,17H,8-11,13-15H2,1-2H3 |
| InChIKey | QGTQDCLHTZSRGW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |