C19H26F2N2O3 — CID 137342576
2-butoxy-1-[4-(2,3-difluoro-4-methylbenzoyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 137342576) has the molecular formula C19H26F2N2O3 and a molecular weight of 368.42 g/mol. Its IUPAC name is 2-butoxy-1-[4-(2,3-difluoro-4-methylbenzoyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 2-butoxy-1-[4-(2,3-difluoro-4-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 137342576 |
| Molecular Formula | C19H26F2N2O3 |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 2-butoxy-1-[4-(2,3-difluoro-4-methylbenzoyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CCCCOCC(=O)N1CCCN(C(=O)c2ccc(C)c(F)c2F)CC1 |
| InChI | InChI=1S/C19H26F2N2O3/c1-3-4-12-26-13-16(24)22-8-5-9-23(11-10-22)19(25)15-7-6-14(2)17(20)18(15)21/h6-7H,3-5,8-13H2,1-2H3 |
| InChIKey | ICYXGBIXFGRLLC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|