C18H23N3O — CID 137343850
[4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(1H-indol-7-yl)methanone (PubChem CID 137343850) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is [4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(1H-indol-7-yl)methanone.
| Compound Name | [4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(1H-indol-7-yl)methanone |
|---|---|
| PubChem CID | 137343850 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | [4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(1H-indol-7-yl)methanone |
| SMILES | C/C=C/CN1CCCN(C(=O)c2cccc3cc[nH]c23)CC1 |
| InChI | InChI=1S/C18H23N3O/c1-2-3-10-20-11-5-12-21(14-13-20)18(22)16-7-4-6-15-8-9-19-17(15)16/h2-4,6-9,19H,5,10-14H2,1H3/b3-2+ |
| InChIKey | ZDVRANLEJBZHER-NSCUHMNNSA-N |
| XLogP | 2.89 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|