C17H23ClN2O2 — CID 134713238
[4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(4-chloro-2-methoxyphenyl)methanone (PubChem CID 134713238) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is [4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(4-chloro-2-methoxyphenyl)methanone.
| Compound Name | [4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(4-chloro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 134713238 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [4-[(E)-but-2-enyl]-1,4-diazepan-1-yl]-(4-chloro-2-methoxyphenyl)methanone |
| SMILES | C/C=C/CN1CCCN(C(=O)c2ccc(Cl)cc2OC)CC1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-3-4-8-19-9-5-10-20(12-11-19)17(21)15-7-6-14(18)13-16(15)22-2/h3-4,6-7,13H,5,8-12H2,1-2H3/b4-3+ |
| InChIKey | DABVEYNTMUFXKE-ONEGZZNKSA-N |
| XLogP | 3.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|