C18H23ClN4O4 — CID 154914106
(4-chloro-2-methoxyphenyl)-[4-(1H-imidazol-2-ylmethyl)-1,4-diazepan-1-yl]methanone;formic acid (PubChem CID 154914106) has the molecular formula C18H23ClN4O4 and a molecular weight of 394.86 g/mol. Its IUPAC name is (4-chloro-2-methoxyphenyl)-[4-(1H-imidazol-2-ylmethyl)-1,4-diazepan-1-yl]methanone;formic acid.
| Compound Name | (4-chloro-2-methoxyphenyl)-[4-(1H-imidazol-2-ylmethyl)-1,4-diazepan-1-yl]methanone;formic acid |
|---|---|
| PubChem CID | 154914106 |
| Molecular Formula | C18H23ClN4O4 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | (4-chloro-2-methoxyphenyl)-[4-(1H-imidazol-2-ylmethyl)-1,4-diazepan-1-yl]methanone;formic acid |
| SMILES | COc1cc(Cl)ccc1C(=O)N1CCCN(Cc2ncc[nH]2)CC1.O=CO |
| InChI | InChI=1S/C17H21ClN4O2.CH2O2/c1-24-15-11-13(18)3-4-14(15)17(23)22-8-2-7-21(9-10-22)12-16-19-5-6-20-16;2-1-3/h3-6,11H,2,7-10,12H2,1H3,(H,19,20);1H,(H,2,3) |
| InChIKey | OFCHXKBZEAVEBQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|