C13H25N3O2 — CID 137344705
[5-(2-morpholin-4-ylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 137344705) has the molecular formula C13H25N3O2 and a molecular weight of 255.36 g/mol. Its IUPAC name is [5-(2-morpholin-4-ylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [5-(2-morpholin-4-ylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 137344705 |
| Molecular Formula | C13H25N3O2 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.19 |
| IUPAC Name | [5-(2-morpholin-4-ylethyl)-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | OCC12CNCC1CN(CCN1CCOCC1)C2 |
| InChI | InChI=1S/C13H25N3O2/c17-11-13-9-14-7-12(13)8-16(10-13)2-1-15-3-5-18-6-4-15/h12,14,17H,1-11H2 |
| InChIKey | ALPNOVJCGHZBOQ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |