C15H18F3N3O — CID 137344903
4-methyl-9-[4-(trifluoromethyl)pyrimidin-2-yl]-1-oxa-9-azaspiro[5.5]undec-4-ene (PubChem CID 137344903) has the molecular formula C15H18F3N3O and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-methyl-9-[4-(trifluoromethyl)pyrimidin-2-yl]-1-oxa-9-azaspiro[5.5]undec-4-ene.
| Compound Name | 4-methyl-9-[4-(trifluoromethyl)pyrimidin-2-yl]-1-oxa-9-azaspiro[5.5]undec-4-ene |
|---|---|
| PubChem CID | 137344903 |
| Molecular Formula | C15H18F3N3O |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 4-methyl-9-[4-(trifluoromethyl)pyrimidin-2-yl]-1-oxa-9-azaspiro[5.5]undec-4-ene |
| SMILES | CC1=CC2(CCN(c3nccc(C(F)(F)F)n3)CC2)OCC1 |
| InChI | InChI=1S/C15H18F3N3O/c1-11-3-9-22-14(10-11)4-7-21(8-5-14)13-19-6-2-12(20-13)15(16,17)18/h2,6,10H,3-5,7-9H2,1H3 |
| InChIKey | IRJHMVINJAHJDG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|