C13H16N2O3 — CID 137348876
methyl 4-propanoyl-2,3-dihydroquinoxaline-1-carboxylate (PubChem CID 137348876) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is methyl 4-propanoyl-2,3-dihydroquinoxaline-1-carboxylate.
| Compound Name | methyl 4-propanoyl-2,3-dihydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 137348876 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | methyl 4-propanoyl-2,3-dihydroquinoxaline-1-carboxylate |
| SMILES | CCC(=O)N1CCN(C(=O)OC)c2ccccc21 |
| InChI | InChI=1S/C13H16N2O3/c1-3-12(16)14-8-9-15(13(17)18-2)11-7-5-4-6-10(11)14/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | WXZWPPNMQAIVTN-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |