C25H53O19P3 — CID 137349538
[(2R)-2,3-bis[(1S)-1-hydroxyoctoxy]propyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate (PubChem CID 137349538) has the molecular formula C25H53O19P3 and a molecular weight of 750.60 g/mol. Its IUPAC name is [(2R)-2,3-bis[(1S)-1-hydroxyoctoxy]propyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate.
| Compound Name | [(2R)-2,3-bis[(1S)-1-hydroxyoctoxy]propyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate |
|---|---|
| PubChem CID | 137349538 |
| Molecular Formula | C25H53O19P3 |
| Molecular Weight | 750.60 g/mol |
| Exact Mass | 750.24 |
| IUPAC Name | [(2R)-2,3-bis[(1S)-1-hydroxyoctoxy]propyl] [(2R,3R,5S,6R)-2,4,6-trihydroxy-3,5-diphosphonooxycyclohexyl] hydrogen phosphate |
| SMILES | CCCCCCC[C@@H](O)OC[C@H](COP(=O)(O)OC1[C@H](O)[C@H](OP(=O)(O)O)C(O)[C@H](OP(=O)(O)O)[C@H]1O)O[C@H](O)CCCCCCC |
| InChI | InChI=1S/C25H53O19P3/c1-3-5-7-9-11-13-18(26)39-15-17(41-19(27)14-12-10-8-6-4-2)16-40-47(37,38)44-25-21(29)23(42-45(31,32)33)20(28)24(22(25)30)43-46(34,35)36/h17-30H,3-16H2,1-2H3,(H,37,38)(H2,31,32,33)(H2,34,35,36)/t17-,18+,19+,20?,21-,22-,23-,24+,25?/m1/s1 |
| InChIKey | YMIVTWICVQDVIN-DBJJFXGYSA-N |
| XLogP | 1.30 |
| TPSA | 308.89 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.60 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|