C22H28FeN4O4 — CID 137349670
2-[[(1R,2R)-2-[carboxymethyl(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron (PubChem CID 137349670) has the molecular formula C22H28FeN4O4 and a molecular weight of 468.34 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-[carboxymethyl(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron.
| Compound Name | 2-[[(1R,2R)-2-[carboxymethyl(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron |
|---|---|
| PubChem CID | 137349670 |
| Molecular Formula | C22H28FeN4O4 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 2-[[(1R,2R)-2-[carboxymethyl(pyridin-2-ylmethyl)amino]cyclohexyl]-(pyridin-2-ylmethyl)amino]acetic acid;iron |
| SMILES | O=C(O)CN(Cc1ccccn1)[C@@H]1CCCC[C@H]1N(CC(=O)O)Cc1ccccn1.[Fe] |
| InChI | InChI=1S/C22H28N4O4.Fe/c27-21(28)15-25(13-17-7-3-5-11-23-17)19-9-1-2-10-20(19)26(16-22(29)30)14-18-8-4-6-12-24-18;/h3-8,11-12,19-20H,1-2,9-10,13-16H2,(H,27,28)(H,29,30);/t19-,20-;/m1./s1 |
| InChIKey | HVQPIYRNANFDOW-GZJHNZOKSA-N |
| XLogP | 2.26 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|