C4H6F2N2O — CID 137352277
2,3-difluoroazetidine-1-carboxamide (PubChem CID 137352277) has the molecular formula C4H6F2N2O and a molecular weight of 136.10 g/mol. Its IUPAC name is 2,3-difluoroazetidine-1-carboxamide.
| Compound Name | 2,3-difluoroazetidine-1-carboxamide |
|---|---|
| PubChem CID | 137352277 |
| Molecular Formula | C4H6F2N2O |
| Molecular Weight | 136.10 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | 2,3-difluoroazetidine-1-carboxamide |
| SMILES | NC(=O)N1CC(F)C1F |
| InChI | InChI=1S/C4H6F2N2O/c5-2-1-8(3(2)6)4(7)9/h2-3H,1H2,(H2,7,9) |
| InChIKey | BXGIHAXWWWWWBQ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.10 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|