C10H9N — CID 137352991
1-ethynyl-2,3-dihydro-1H-isoindole (PubChem CID 137352991) has the molecular formula C10H9N and a molecular weight of 143.19 g/mol. Its IUPAC name is 1-ethynyl-2,3-dihydro-1H-isoindole.
| Compound Name | 1-ethynyl-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 137352991 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.07 |
| IUPAC Name | 1-ethynyl-2,3-dihydro-1H-isoindole |
| SMILES | C#CC1NCc2ccccc21 |
| InChI | InChI=1S/C10H9N/c1-2-10-9-6-4-3-5-8(9)7-11-10/h1,3-6,10-11H,7H2 |
| InChIKey | STJGHKIASGFWKZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|