C24H26F5NO10 — CID 137353344
(2,3,4,5,6-pentafluorophenyl) 5-[[(1S,2R,3R,4R,5S)-4-acetamido-2,3-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]pentanoate (PubChem CID 137353344) has the molecular formula C24H26F5NO10 and a molecular weight of 583.46 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-[[(1S,2R,3R,4R,5S)-4-acetamido-2,3-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]pentanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-[[(1S,2R,3R,4R,5S)-4-acetamido-2,3-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]pentanoate |
|---|---|
| PubChem CID | 137353344 |
| Molecular Formula | C24H26F5NO10 |
| Molecular Weight | 583.46 g/mol |
| Exact Mass | 583.15 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-[[(1S,2R,3R,4R,5S)-4-acetamido-2,3-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-1-yl]methoxy]pentanoate |
| SMILES | CC(=O)N[C@H]1[C@H]2OC[C@](COCCCCC(=O)Oc3c(F)c(F)c(F)c(F)c3F)(O2)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H26F5NO10/c1-10(31)30-19-21(37-11(2)32)22(38-12(3)33)24(9-36-23(19)40-24)8-35-7-5-4-6-13(34)39-20-17(28)15(26)14(25)16(27)18(20)29/h19,21-23H,4-9H2,1-3H3,(H,30,31)/t19-,21-,22-,23+,24+/m1/s1 |
| InChIKey | XXVMFGQPHPKBKE-GKMGCJOJSA-N |
| XLogP | 1.97 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|