C17H16N6O2 — CID 137353855
ethyl 11-(3,5-dimethyltriazol-4-yl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate (PubChem CID 137353855) has the molecular formula C17H16N6O2 and a molecular weight of 336.36 g/mol. Its IUPAC name is ethyl 11-(3,5-dimethyltriazol-4-yl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate.
| Compound Name | ethyl 11-(3,5-dimethyltriazol-4-yl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
|---|---|
| PubChem CID | 137353855 |
| Molecular Formula | C17H16N6O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | ethyl 11-(3,5-dimethyltriazol-4-yl)-3,8,13-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-5-carboxylate |
| SMILES | CCOC(=O)c1cnc2c(c1)[nH]c1cc(-c3c(C)nnn3C)cnc12 |
| InChI | InChI=1S/C17H16N6O2/c1-4-25-17(24)11-6-13-15(19-8-11)14-12(20-13)5-10(7-18-14)16-9(2)21-22-23(16)3/h5-8,20H,4H2,1-3H3 |
| InChIKey | LPLGNWMLPWJMMI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |